C18H21NO5 — CID 53474427
prop-2-enyl (4S)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazole-4-carboxylate (PubChem CID 53474427) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is prop-2-enyl (4S)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazole-4-carboxylate.
| Compound Name | prop-2-enyl (4S)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 53474427 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | prop-2-enyl (4S)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazole-4-carboxylate |
| SMILES | C=CCOC(=O)[C@]1(CC(C)C)N=C(c2ccc(OC)cc2)OC1=O |
| InChI | InChI=1S/C18H21NO5/c1-5-10-23-16(20)18(11-12(2)3)17(21)24-15(19-18)13-6-8-14(22-4)9-7-13/h5-9,12H,1,10-11H2,2-4H3/t18-/m0/s1 |
| InChIKey | QQURYFRKRQHUPW-SFHVURJKSA-N |
| XLogP | 2.51 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|