C21H18ClNO5 — CID 102198824
methyl (E)-3-[(4S)-4-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-yl]prop-2-enoate (PubChem CID 102198824) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is methyl (E)-3-[(4S)-4-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4S)-4-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102198824 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | methyl (E)-3-[(4S)-4-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@]1(Cc2ccc(Cl)cc2)N=C(c2ccc(OC)cc2)OC1=O |
| InChI | InChI=1S/C21H18ClNO5/c1-26-17-9-5-15(6-10-17)19-23-21(20(25)28-19,12-11-18(24)27-2)13-14-3-7-16(22)8-4-14/h3-12H,13H2,1-2H3/b12-11+/t21-/m1/s1 |
| InChIKey | ZIOPCPWFCCTANE-RJRNSMGGSA-N |
| XLogP | 3.36 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|