C23H23NO3 — CID 56600507
(4R)-4-[(1S)-1-(4-methoxyphenyl)but-3-enyl]-2-phenyl-4-prop-2-enyl-1,3-oxazol-5-one (PubChem CID 56600507) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (4R)-4-[(1S)-1-(4-methoxyphenyl)but-3-enyl]-2-phenyl-4-prop-2-enyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-[(1S)-1-(4-methoxyphenyl)but-3-enyl]-2-phenyl-4-prop-2-enyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 56600507 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (4R)-4-[(1S)-1-(4-methoxyphenyl)but-3-enyl]-2-phenyl-4-prop-2-enyl-1,3-oxazol-5-one |
| SMILES | C=CC[C@@H](c1ccc(OC)cc1)[C@@]1(CC=C)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C23H23NO3/c1-4-9-20(17-12-14-19(26-3)15-13-17)23(16-5-2)22(25)27-21(24-23)18-10-7-6-8-11-18/h4-8,10-15,20H,1-2,9,16H2,3H3/t20-,23+/m0/s1 |
| InChIKey | INDDWGBJELXRGY-NZQKXSOJSA-N |
| XLogP | 4.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|