C19H16FNO2 — CID 102582088
(4S)-4-[(1R)-1-(4-fluorophenyl)prop-2-enyl]-4-methyl-2-phenyl-1,3-oxazol-5-one (PubChem CID 102582088) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-(4-fluorophenyl)prop-2-enyl]-4-methyl-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4S)-4-[(1R)-1-(4-fluorophenyl)prop-2-enyl]-4-methyl-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 102582088 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (4S)-4-[(1R)-1-(4-fluorophenyl)prop-2-enyl]-4-methyl-2-phenyl-1,3-oxazol-5-one |
| SMILES | C=C[C@H](c1ccc(F)cc1)[C@]1(C)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C19H16FNO2/c1-3-16(13-9-11-15(20)12-10-13)19(2)18(22)23-17(21-19)14-7-5-4-6-8-14/h3-12,16H,1H2,2H3/t16-,19+/m1/s1 |
| InChIKey | KNPXQESKRVQQJC-APWZRJJASA-N |
| XLogP | 3.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|