C15H17NO4 — CID 102179165
2-methylpropyl (4R)-4-methyl-5-oxo-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 102179165) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-methylpropyl (4R)-4-methyl-5-oxo-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | 2-methylpropyl (4R)-4-methyl-5-oxo-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102179165 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-methylpropyl (4R)-4-methyl-5-oxo-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)COC(=O)[C@@]1(C)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C15H17NO4/c1-10(2)9-19-13(17)15(3)14(18)20-12(16-15)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3/t15-/m1/s1 |
| InChIKey | MOKMNDOKJDSRIJ-OAHLLOKOSA-N |
| XLogP | 1.95 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|