C23H37NO8P2 — CID 122222427
4-[2,2-bis(diethoxyphosphoryl)ethyl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one (PubChem CID 122222427) has the molecular formula C23H37NO8P2 and a molecular weight of 517.50 g/mol. Its IUPAC name is 4-[2,2-bis(diethoxyphosphoryl)ethyl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[2,2-bis(diethoxyphosphoryl)ethyl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 122222427 |
| Molecular Formula | C23H37NO8P2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 4-[2,2-bis(diethoxyphosphoryl)ethyl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one |
| SMILES | CCOP(=O)(OCC)C(CC1(CC(C)C)N=C(c2ccccc2)OC1=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C23H37NO8P2/c1-7-28-33(26,29-8-2)20(34(27,30-9-3)31-10-4)17-23(16-18(5)6)22(25)32-21(24-23)19-14-12-11-13-15-19/h11-15,18,20H,7-10,16-17H2,1-6H3 |
| InChIKey | DIPZXNOZVDYVCX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|