C16H17NO2 — CID 11594055
(5S)-2-phenyl-9-propan-2-yl-3-oxa-1-azaspiro[4.4]nona-1,8-dien-4-one (PubChem CID 11594055) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (5S)-2-phenyl-9-propan-2-yl-3-oxa-1-azaspiro[4.4]nona-1,8-dien-4-one.
| Compound Name | (5S)-2-phenyl-9-propan-2-yl-3-oxa-1-azaspiro[4.4]nona-1,8-dien-4-one |
|---|---|
| PubChem CID | 11594055 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (5S)-2-phenyl-9-propan-2-yl-3-oxa-1-azaspiro[4.4]nona-1,8-dien-4-one |
| SMILES | CC(C)C1=CCC[C@]12N=C(c1ccccc1)OC2=O |
| InChI | InChI=1S/C16H17NO2/c1-11(2)13-9-6-10-16(13)15(18)19-14(17-16)12-7-4-3-5-8-12/h3-5,7-9,11H,6,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | RCOQPJOYIKDRIT-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|