C12H11F2NO2 — CID 46919167
2-(2,4-difluorophenyl)-4-propan-2-yl-4H-1,3-oxazol-5-one (PubChem CID 46919167) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-propan-2-yl-4H-1,3-oxazol-5-one.
| Compound Name | 2-(2,4-difluorophenyl)-4-propan-2-yl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 46919167 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-propan-2-yl-4H-1,3-oxazol-5-one |
| SMILES | CC(C)C1N=C(c2ccc(F)cc2F)OC1=O |
| InChI | InChI=1S/C12H11F2NO2/c1-6(2)10-12(16)17-11(15-10)8-4-3-7(13)5-9(8)14/h3-6,10H,1-2H3 |
| InChIKey | GTCFJFZQVLEFGO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |