C29H52O13P4 — CID 56934533
3,3-bis[2,2-bis(diethoxyphosphoryl)ethyl]-1H-inden-2-one (PubChem CID 56934533) has the molecular formula C29H52O13P4 and a molecular weight of 732.62 g/mol. Its IUPAC name is 3,3-bis[2,2-bis(diethoxyphosphoryl)ethyl]-1H-inden-2-one.
| Compound Name | 3,3-bis[2,2-bis(diethoxyphosphoryl)ethyl]-1H-inden-2-one |
|---|---|
| PubChem CID | 56934533 |
| Molecular Formula | C29H52O13P4 |
| Molecular Weight | 732.62 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | 3,3-bis[2,2-bis(diethoxyphosphoryl)ethyl]-1H-inden-2-one |
| SMILES | CCOP(=O)(OCC)C(CC1(CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC)C(=O)Cc2ccccc21)P(=O)(OCC)OCC |
| InChI | InChI=1S/C29H52O13P4/c1-9-35-43(31,36-10-2)27(44(32,37-11-3)38-12-4)22-29(25-20-18-17-19-24(25)21-26(29)30)23-28(45(33,39-13-5)40-14-6)46(34,41-15-7)42-16-8/h17-20,27-28H,9-16,21-23H2,1-8H3 |
| InChIKey | VPDURNFMSIDOEK-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.62 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|