C12H13NO — CID 170719350
1'-methylspiro[1H-indene-3,3'-azetidine]-2-one (PubChem CID 170719350) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1'-methylspiro[1H-indene-3,3'-azetidine]-2-one.
| Compound Name | 1'-methylspiro[1H-indene-3,3'-azetidine]-2-one |
|---|---|
| PubChem CID | 170719350 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1'-methylspiro[1H-indene-3,3'-azetidine]-2-one |
| SMILES | CN1CC2(C1)C(=O)Cc1ccccc12 |
| InChI | InChI=1S/C12H13NO/c1-13-7-12(8-13)10-5-3-2-4-9(10)6-11(12)14/h2-5H,6-8H2,1H3 |
| InChIKey | LANFMENVICUNSY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |