C8H11NO4 — CID 154091027
ethyl 2,4-dimethyl-5-oxo-1,3-oxazole-4-carboxylate (PubChem CID 154091027) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-oxo-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-oxo-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 154091027 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | ethyl 2,4-dimethyl-5-oxo-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)C1(C)N=C(C)OC1=O |
| InChI | InChI=1S/C8H11NO4/c1-4-12-6(10)8(3)7(11)13-5(2)9-8/h4H2,1-3H3 |
| InChIKey | DLRAKJSNERUGLK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|