C27H24N2O2 — CID 71604937
(4S)-4-methyl-4-[(R)-(2-methyl-1H-indol-3-yl)-(4-methylphenyl)methyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 71604937) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is (4S)-4-methyl-4-[(R)-(2-methyl-1H-indol-3-yl)-(4-methylphenyl)methyl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4S)-4-methyl-4-[(R)-(2-methyl-1H-indol-3-yl)-(4-methylphenyl)methyl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71604937 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (4S)-4-methyl-4-[(R)-(2-methyl-1H-indol-3-yl)-(4-methylphenyl)methyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | Cc1ccc([C@H](c2c(C)[nH]c3ccccc23)[C@]2(C)N=C(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-17-13-15-19(16-14-17)24(23-18(2)28-22-12-8-7-11-21(22)23)27(3)26(30)31-25(29-27)20-9-5-4-6-10-20/h4-16,24,28H,1-3H3/t24-,27+/m1/s1 |
| InChIKey | PZUJVONNBDTCAU-SQHAQQRYSA-N |
| XLogP | 5.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|