C13H13F3O3 — CID 71473221
prop-2-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)propanoate (PubChem CID 71473221) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is prop-2-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)propanoate.
| Compound Name | prop-2-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 71473221 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | prop-2-enyl 3,3,3-trifluoro-2-(4-methoxyphenyl)propanoate |
| SMILES | C=CCOC(=O)C(c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O3/c1-3-8-19-12(17)11(13(14,15)16)9-4-6-10(18-2)7-5-9/h3-7,11H,1,8H2,2H3 |
| InChIKey | ZIIDCTSQOUQVMT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|