C14H17Br2NO3 — CID 176895460
methyl 2,2-dibromo-3-(4-methoxyphenyl)-3-(prop-2-enylamino)propanoate (PubChem CID 176895460) has the molecular formula C14H17Br2NO3 and a molecular weight of 407.10 g/mol. Its IUPAC name is methyl 2,2-dibromo-3-(4-methoxyphenyl)-3-(prop-2-enylamino)propanoate.
| Compound Name | methyl 2,2-dibromo-3-(4-methoxyphenyl)-3-(prop-2-enylamino)propanoate |
|---|---|
| PubChem CID | 176895460 |
| Molecular Formula | C14H17Br2NO3 |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | methyl 2,2-dibromo-3-(4-methoxyphenyl)-3-(prop-2-enylamino)propanoate |
| SMILES | C=CCNC(c1ccc(OC)cc1)C(Br)(Br)C(=O)OC |
| InChI | InChI=1S/C14H17Br2NO3/c1-4-9-17-12(14(15,16)13(18)20-3)10-5-7-11(19-2)8-6-10/h4-8,12,17H,1,9H2,2-3H3 |
| InChIKey | WVILVLXHELEWLA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|