C12H14N2O3 — CID 3102348
N'-(4-methoxyphenyl)-N-prop-2-enyloxamide (PubChem CID 3102348) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is N'-(4-methoxyphenyl)-N-prop-2-enyloxamide.
| Compound Name | N'-(4-methoxyphenyl)-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 3102348 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N'-(4-methoxyphenyl)-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-3-8-13-11(15)12(16)14-9-4-6-10(17-2)7-5-9/h3-7H,1,8H2,2H3,(H,13,15)(H,14,16) |
| InChIKey | UUCMYZKHTZDTID-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|