C25H27NO5 — CID 132508808
benzyl (E)-4-[(4R)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazol-4-yl]but-2-enoate (PubChem CID 132508808) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is benzyl (E)-4-[(4R)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazol-4-yl]but-2-enoate.
| Compound Name | benzyl (E)-4-[(4R)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazol-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 132508808 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | benzyl (E)-4-[(4R)-2-(4-methoxyphenyl)-4-(2-methylpropyl)-5-oxo-1,3-oxazol-4-yl]but-2-enoate |
| SMILES | COc1ccc(C2=N[C@@](C/C=C/C(=O)OCc3ccccc3)(CC(C)C)C(=O)O2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-18(2)16-25(15-7-10-22(27)30-17-19-8-5-4-6-9-19)24(28)31-23(26-25)20-11-13-21(29-3)14-12-20/h4-14,18H,15-17H2,1-3H3/b10-7+/t25-/m0/s1 |
| InChIKey | YZAQWZYFAZENPJ-HJKZNEBBSA-N |
| XLogP | 4.47 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|