C31H30Cl3NO7P2 — CID 15372579
3-diethoxyphosphoryl-2,2,2-triphenoxy-5-phenyl-3-(trichloromethyl)-1,4,2λ5-oxazaphosphole (PubChem CID 15372579) has the molecular formula C31H30Cl3NO7P2 and a molecular weight of 696.89 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-2,2,2-triphenoxy-5-phenyl-3-(trichloromethyl)-1,4,2λ5-oxazaphosphole.
| Compound Name | 3-diethoxyphosphoryl-2,2,2-triphenoxy-5-phenyl-3-(trichloromethyl)-1,4,2λ5-oxazaphosphole |
|---|---|
| PubChem CID | 15372579 |
| Molecular Formula | C31H30Cl3NO7P2 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | 3-diethoxyphosphoryl-2,2,2-triphenoxy-5-phenyl-3-(trichloromethyl)-1,4,2λ5-oxazaphosphole |
| SMILES | CCOP(=O)(OCC)C1(C(Cl)(Cl)Cl)N=C(c2ccccc2)OP1(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C31H30Cl3NO7P2/c1-3-37-43(36,38-4-2)31(30(32,33)34)35-29(25-17-9-5-10-18-25)42-44(31,39-26-19-11-6-12-20-26,40-27-21-13-7-14-22-27)41-28-23-15-8-16-24-28/h5-24H,3-4H2,1-2H3 |
| InChIKey | NYXYVFVDKJOCQK-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|