C21H23N2O4P — CID 101435527
5-(3-diethoxyphosphoryl-3-phenylazirin-2-yl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 101435527) has the molecular formula C21H23N2O4P and a molecular weight of 398.40 g/mol. Its IUPAC name is 5-(3-diethoxyphosphoryl-3-phenylazirin-2-yl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(3-diethoxyphosphoryl-3-phenylazirin-2-yl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 101435527 |
| Molecular Formula | C21H23N2O4P |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-(3-diethoxyphosphoryl-3-phenylazirin-2-yl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | CCOP(=O)(OCC)C1(c2ccccc2)N=C1C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C21H23N2O4P/c1-3-25-28(24,26-4-2)21(17-13-9-6-10-14-17)20(22-21)19-15-18(23-27-19)16-11-7-5-8-12-16/h5-14,19H,3-4,15H2,1-2H3 |
| InChIKey | GOEBNTYUFKOIDT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|