About 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid
2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid (PubChem CID 25115791) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid |
| PubChem CID | 25115791 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid |
| SMILES | CCOC(Cc1cccc(C2=NOC(c3ccccc3)C2)c1)C(=O)O |
| InChI | InChI=1S/C20H21NO4/c1-2-24-19(20(22)23)12-14-7-6-10-16(11-14)17-13-18(25-21-17)15-8-4-3-5-9-15/h3-11,18-19H,2,12-13H2,1H3,(H,22,23) |
| InChIKey | DDXOKUHUAQEPLL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid?
The IUPAC name of 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid (CID 25115791) is 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid.
What is the SMILES notation for 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid?
The canonical SMILES for 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid is CCOC(Cc1cccc(C2=NOC(c3ccccc3)C2)c1)C(=O)O.
What is the InChIKey of 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid?
The InChIKey is DDXOKUHUAQEPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4/c1-2-24-19(20(22)23)12-14-7-6-10-16(11-14)17-13-18(25-21-17)15-8-4-3-5-9-15/h3-11,18-19H,2,12-13H2,1H3,(H,22,23).
What are the key properties of 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid?
2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid has a molecular weight of 339.39 g/mol, XLogP of 3.58, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-[3-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]propanoic acid is sourced from PubChem (CID 25115791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).