C12H10ClF2NO3 — CID 102002986
methyl (4S,5S)-5-[chloro(difluoro)methyl]-5-phenyl-4H-1,3-oxazole-4-carboxylate (PubChem CID 102002986) has the molecular formula C12H10ClF2NO3 and a molecular weight of 289.67 g/mol. Its IUPAC name is methyl (4S,5S)-5-[chloro(difluoro)methyl]-5-phenyl-4H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5S)-5-[chloro(difluoro)methyl]-5-phenyl-4H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102002986 |
| Molecular Formula | C12H10ClF2NO3 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl (4S,5S)-5-[chloro(difluoro)methyl]-5-phenyl-4H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@H]1N=CO[C@]1(c1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C12H10ClF2NO3/c1-18-10(17)9-11(12(13,14)15,19-7-16-9)8-5-3-2-4-6-8/h2-7,9H,1H3/t9-,11+/m1/s1 |
| InChIKey | UJYXSISLOQZMJP-KOLCDFICSA-N |
| XLogP | 2.31 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|