C24H22ClN2O3P — CID 135065585
methyl (4R,5S)-5-(4-chlorophenyl)-1-diphenylphosphoryl-5-methyl-4H-imidazole-4-carboxylate (PubChem CID 135065585) has the molecular formula C24H22ClN2O3P and a molecular weight of 452.88 g/mol. Its IUPAC name is methyl (4R,5S)-5-(4-chlorophenyl)-1-diphenylphosphoryl-5-methyl-4H-imidazole-4-carboxylate.
| Compound Name | methyl (4R,5S)-5-(4-chlorophenyl)-1-diphenylphosphoryl-5-methyl-4H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 135065585 |
| Molecular Formula | C24H22ClN2O3P |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | methyl (4R,5S)-5-(4-chlorophenyl)-1-diphenylphosphoryl-5-methyl-4H-imidazole-4-carboxylate |
| SMILES | COC(=O)[C@@H]1N=CN(P(=O)(c2ccccc2)c2ccccc2)[C@@]1(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN2O3P/c1-24(18-13-15-19(25)16-14-18)22(23(28)30-2)26-17-27(24)31(29,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-17,22H,1-2H3/t22-,24-/m0/s1 |
| InChIKey | GSSIXBNTAMGMDV-UPVQGACJSA-N |
| XLogP | 4.37 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|