C19H19NO4 — CID 101488537
methyl (1'S,4R,5'R,6'R,7'R)-7'-methyl-4'-oxo-6'-phenylspiro[4H-1,3-oxazole-5,8'-bicyclo[3.2.1]oct-2-ene]-4-carboxylate (PubChem CID 101488537) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl (1'S,4R,5'R,6'R,7'R)-7'-methyl-4'-oxo-6'-phenylspiro[4H-1,3-oxazole-5,8'-bicyclo[3.2.1]oct-2-ene]-4-carboxylate.
| Compound Name | methyl (1'S,4R,5'R,6'R,7'R)-7'-methyl-4'-oxo-6'-phenylspiro[4H-1,3-oxazole-5,8'-bicyclo[3.2.1]oct-2-ene]-4-carboxylate |
|---|---|
| PubChem CID | 101488537 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | methyl (1'S,4R,5'R,6'R,7'R)-7'-methyl-4'-oxo-6'-phenylspiro[4H-1,3-oxazole-5,8'-bicyclo[3.2.1]oct-2-ene]-4-carboxylate |
| SMILES | COC(=O)[C@@H]1N=COC12C1C=CC(=O)[C@@H]2[C@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H19NO4/c1-11-13-8-9-14(21)16(15(11)12-6-4-3-5-7-12)19(13)17(18(22)23-2)20-10-24-19/h3-11,13,15-17H,1-2H3/t11-,13?,15-,16+,17-,19?/m0/s1 |
| InChIKey | BOTUALQNJNZHKF-QIDGEOLRSA-N |
| XLogP | 2.13 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |