C15H12O3S — CID 135038329
methyl (5S,6R)-4-oxo-6-phenyl-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate (PubChem CID 135038329) has the molecular formula C15H12O3S and a molecular weight of 272.32 g/mol. Its IUPAC name is methyl (5S,6R)-4-oxo-6-phenyl-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate.
| Compound Name | methyl (5S,6R)-4-oxo-6-phenyl-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 135038329 |
| Molecular Formula | C15H12O3S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | methyl (5S,6R)-4-oxo-6-phenyl-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)c2ccsc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H12O3S/c1-18-15(17)12-11(9-5-3-2-4-6-9)14-10(13(12)16)7-8-19-14/h2-8,11-12H,1H3/t11-,12-/m0/s1 |
| InChIKey | FFQUCJPGBGFAOC-RYUDHWBXSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|