C19H14O3S — CID 135013439
methyl (5S,6R)-6-naphthalen-2-yl-4-oxo-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate (PubChem CID 135013439) has the molecular formula C19H14O3S and a molecular weight of 322.38 g/mol. Its IUPAC name is methyl (5S,6R)-6-naphthalen-2-yl-4-oxo-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate.
| Compound Name | methyl (5S,6R)-6-naphthalen-2-yl-4-oxo-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 135013439 |
| Molecular Formula | C19H14O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl (5S,6R)-6-naphthalen-2-yl-4-oxo-5,6-dihydrocyclopenta[b]thiophene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)c2ccsc2[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H14O3S/c1-22-19(21)16-15(18-14(17(16)20)8-9-23-18)13-7-6-11-4-2-3-5-12(11)10-13/h2-10,15-16H,1H3/t15-,16-/m0/s1 |
| InChIKey | IIQKAPHYHQIITE-HOTGVXAUSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|