C15H10F9NO3 — CID 102002988
methyl (4S,5S)-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-phenyl-4H-1,3-oxazole-4-carboxylate (PubChem CID 102002988) has the molecular formula C15H10F9NO3 and a molecular weight of 423.23 g/mol. Its IUPAC name is methyl (4S,5S)-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-phenyl-4H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5S)-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-phenyl-4H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102002988 |
| Molecular Formula | C15H10F9NO3 |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | methyl (4S,5S)-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-phenyl-4H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@H]1N=CO[C@]1(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H10F9NO3/c1-27-10(26)9-11(28-7-25-9,8-5-3-2-4-6-8)12(16,17)13(18,19)14(20,21)15(22,23)24/h2-7,9H,1H3/t9-,11+/m1/s1 |
| InChIKey | XPVCLDOMIHXYIN-KOLCDFICSA-N |
| XLogP | 3.95 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|