C25H20F18O7 — CID 124833306
diethyl (2R,3S,5R,6R)-2,6-dihydroxy-2,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-phenyloxane-3,5-dicarboxylate (PubChem CID 124833306) has the molecular formula C25H20F18O7 and a molecular weight of 774.39 g/mol. Its IUPAC name is diethyl (2R,3S,5R,6R)-2,6-dihydroxy-2,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-phenyloxane-3,5-dicarboxylate.
| Compound Name | diethyl (2R,3S,5R,6R)-2,6-dihydroxy-2,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-phenyloxane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 124833306 |
| Molecular Formula | C25H20F18O7 |
| Molecular Weight | 774.39 g/mol |
| Exact Mass | 774.09 |
| IUPAC Name | diethyl (2R,3S,5R,6R)-2,6-dihydroxy-2,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-phenyloxane-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(c2ccccc2)[C@H](C(=O)OCC)[C@](O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[C@@]1(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H20F18O7/c1-3-48-14(44)12-11(10-8-6-5-7-9-10)13(15(45)49-4-2)17(47,19(28,29)21(32,33)23(36,37)25(41,42)43)50-16(12,46)18(26,27)20(30,31)22(34,35)24(38,39)40/h5-9,11-13,46-47H,3-4H2,1-2H3/t11?,12-,13+,16-,17-/m1/s1 |
| InChIKey | VADLDXMTZVOQGZ-BZSADYMVSA-N |
| XLogP | 6.47 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.39 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|