C17H16F8N2O4 — CID 98203748
ethyl (4R,5R,6R)-4-hydroxy-4-(1,1,2,2,3,3,4,4-octafluorobutyl)-2-oxo-6-phenyl-1,3-diazinane-5-carboxylate (PubChem CID 98203748) has the molecular formula C17H16F8N2O4 and a molecular weight of 464.31 g/mol. Its IUPAC name is ethyl (4R,5R,6R)-4-hydroxy-4-(1,1,2,2,3,3,4,4-octafluorobutyl)-2-oxo-6-phenyl-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4R,5R,6R)-4-hydroxy-4-(1,1,2,2,3,3,4,4-octafluorobutyl)-2-oxo-6-phenyl-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 98203748 |
| Molecular Formula | C17H16F8N2O4 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | ethyl (4R,5R,6R)-4-hydroxy-4-(1,1,2,2,3,3,4,4-octafluorobutyl)-2-oxo-6-phenyl-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccccc2)NC(=O)N[C@]1(O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H16F8N2O4/c1-2-31-11(28)9-10(8-6-4-3-5-7-8)26-13(29)27-15(9,30)17(24,25)16(22,23)14(20,21)12(18)19/h3-7,9-10,12,30H,2H2,1H3,(H2,26,27,29)/t9-,10-,15+/m0/s1 |
| InChIKey | QADQQXJZXAPJIY-AMJWSMQMSA-N |
| XLogP | 3.08 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|