C17H15F9N2O3S — CID 98203779
ethyl (4R,5R,6S)-4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 98203779) has the molecular formula C17H15F9N2O3S and a molecular weight of 498.37 g/mol. Its IUPAC name is ethyl (4R,5R,6S)-4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4R,5R,6S)-4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 98203779 |
| Molecular Formula | C17H15F9N2O3S |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | ethyl (4R,5R,6S)-4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-6-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)NC(=S)N[C@]1(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H15F9N2O3S/c1-2-31-11(29)9-10(8-6-4-3-5-7-8)27-12(32)28-13(9,30)14(18,19)15(20,21)16(22,23)17(24,25)26/h3-7,9-10,30H,2H2,1H3,(H2,27,28,32)/t9-,10+,13+/m0/s1 |
| InChIKey | WYFGGVSUGAVBJA-OPQQBVKSSA-N |
| XLogP | 3.54 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|