C12H13F3N2O3S2 — CID 1424989
ethyl (4S,5R,6R)-4-hydroxy-2-sulfanylidene-6-thiophen-2-yl-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate (PubChem CID 1424989) has the molecular formula C12H13F3N2O3S2 and a molecular weight of 354.38 g/mol. Its IUPAC name is ethyl (4S,5R,6R)-4-hydroxy-2-sulfanylidene-6-thiophen-2-yl-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4S,5R,6R)-4-hydroxy-2-sulfanylidene-6-thiophen-2-yl-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 1424989 |
| Molecular Formula | C12H13F3N2O3S2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | ethyl (4S,5R,6R)-4-hydroxy-2-sulfanylidene-6-thiophen-2-yl-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2cccs2)NC(=S)N[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3S2/c1-2-20-9(18)7-8(6-4-3-5-22-6)16-10(21)17-11(7,19)12(13,14)15/h3-5,7-8,19H,2H2,1H3,(H2,16,17,21)/t7-,8-,11-/m0/s1 |
| InChIKey | RMBQHRPHRFGDRH-LAEOZQHASA-N |
| XLogP | 1.70 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|