C14H14ClF3N2O3S — CID 7745768
ethyl (4R,5R,6R)-6-(4-chlorophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate (PubChem CID 7745768) has the molecular formula C14H14ClF3N2O3S and a molecular weight of 382.79 g/mol. Its IUPAC name is ethyl (4R,5R,6R)-6-(4-chlorophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4R,5R,6R)-6-(4-chlorophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 7745768 |
| Molecular Formula | C14H14ClF3N2O3S |
| Molecular Weight | 382.79 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | ethyl (4R,5R,6R)-6-(4-chlorophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(Cl)cc2)NC(=S)N[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C14H14ClF3N2O3S/c1-2-23-11(21)9-10(7-3-5-8(15)6-4-7)19-12(24)20-13(9,22)14(16,17)18/h3-6,9-10,22H,2H2,1H3,(H2,19,20,24)/t9-,10-,13+/m0/s1 |
| InChIKey | WOPRLQIRUQIUTM-OUJBWJOFSA-N |
| XLogP | 2.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|