C16H19F3N2O5S — CID 2920809
ethyl 6-(2,3-dimethoxyphenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate (PubChem CID 2920809) has the molecular formula C16H19F3N2O5S and a molecular weight of 408.40 g/mol. Its IUPAC name is ethyl 6-(2,3-dimethoxyphenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl 6-(2,3-dimethoxyphenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2920809 |
| Molecular Formula | C16H19F3N2O5S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | ethyl 6-(2,3-dimethoxyphenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)C1C(c2cccc(OC)c2OC)NC(=S)NC1(O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O5S/c1-4-26-13(22)10-11(8-6-5-7-9(24-2)12(8)25-3)20-14(27)21-15(10,23)16(17,18)19/h5-7,10-11,23H,4H2,1-3H3,(H2,20,21,27) |
| InChIKey | SDILKHRCSNPCIQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|