C15H17F3N2O3S — CID 25444869
ethyl (4S,5R,6S)-6-hydroxy-1-methyl-4-phenyl-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinane-5-carboxylate (PubChem CID 25444869) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is ethyl (4S,5R,6S)-6-hydroxy-1-methyl-4-phenyl-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4S,5R,6S)-6-hydroxy-1-methyl-4-phenyl-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 25444869 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | ethyl (4S,5R,6S)-6-hydroxy-1-methyl-4-phenyl-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)NC(=S)N(C)[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O3S/c1-3-23-12(21)10-11(9-7-5-4-6-8-9)19-13(24)20(2)14(10,22)15(16,17)18/h4-8,10-11,22H,3H2,1-2H3,(H,19,24)/t10-,11+,14-/m0/s1 |
| InChIKey | XHFUEAPNRAWBBO-WDMOLILDSA-N |
| XLogP | 1.98 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|