C19H20F7NO6 — CID 124768054
diethyl (2R,3R,5S,6R)-4-(4-fluorophenyl)-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate (PubChem CID 124768054) has the molecular formula C19H20F7NO6 and a molecular weight of 491.36 g/mol. Its IUPAC name is diethyl (2R,3R,5S,6R)-4-(4-fluorophenyl)-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate.
| Compound Name | diethyl (2R,3R,5S,6R)-4-(4-fluorophenyl)-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 124768054 |
| Molecular Formula | C19H20F7NO6 |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | diethyl (2R,3R,5S,6R)-4-(4-fluorophenyl)-2,6-dihydroxy-2,6-bis(trifluoromethyl)piperidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(c2ccc(F)cc2)[C@H](C(=O)OCC)[C@@](O)(C(F)(F)F)N[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C19H20F7NO6/c1-3-32-14(28)12-11(9-5-7-10(20)8-6-9)13(15(29)33-4-2)17(31,19(24,25)26)27-16(12,30)18(21,22)23/h5-8,11-13,27,30-31H,3-4H2,1-2H3/t11?,12-,13+,16-,17-/m1/s1 |
| InChIKey | LJNCRMQIEZEHFK-BZSADYMVSA-N |
| XLogP | 2.37 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |