C25H25N2O4P — CID 135065394
methyl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate (PubChem CID 135065394) has the molecular formula C25H25N2O4P and a molecular weight of 448.46 g/mol. Its IUPAC name is methyl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate.
| Compound Name | methyl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 135065394 |
| Molecular Formula | C25H25N2O4P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | methyl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate |
| SMILES | COC(=O)[C@@H]1N=CN(P(=O)(c2ccccc2)c2ccccc2)[C@@]1(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H25N2O4P/c1-25(19-14-16-20(30-2)17-15-19)23(24(28)31-3)26-18-27(25)32(29,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-18,23H,1-3H3/t23-,25-/m0/s1 |
| InChIKey | CDTLYZKKBCSUEO-ZCYQVOJMSA-N |
| XLogP | 3.72 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|