C22H18N2O5S — CID 98238392
dimethyl (1R,7R,8R,9R)-1,7-diphenyl-4-oxa-10-thia-3,5-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-dicarboxylate (PubChem CID 98238392) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is dimethyl (1R,7R,8R,9R)-1,7-diphenyl-4-oxa-10-thia-3,5-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-dicarboxylate.
| Compound Name | dimethyl (1R,7R,8R,9R)-1,7-diphenyl-4-oxa-10-thia-3,5-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 98238392 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | dimethyl (1R,7R,8R,9R)-1,7-diphenyl-4-oxa-10-thia-3,5-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@]2(c3ccccc3)S[C@]1(c1ccccc1)c1nonc12 |
| InChI | InChI=1S/C22H18N2O5S/c1-27-19(25)15-16(20(26)28-2)22(14-11-7-4-8-12-14)18-17(23-29-24-18)21(15,30-22)13-9-5-3-6-10-13/h3-12,15-16H,1-2H3/t15-,16-,21+,22+/m1/s1 |
| InChIKey | WMYNBFSSDULHTQ-DJDZNOHASA-N |
| XLogP | 2.90 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |