C26H26O3Se — CID 100988121
methyl (3R,4S,5R)-5-ethyl-2,2-diphenyl-4-phenylselanyloxolane-3-carboxylate (PubChem CID 100988121) has the molecular formula C26H26O3Se and a molecular weight of 465.45 g/mol. Its IUPAC name is methyl (3R,4S,5R)-5-ethyl-2,2-diphenyl-4-phenylselanyloxolane-3-carboxylate.
| Compound Name | methyl (3R,4S,5R)-5-ethyl-2,2-diphenyl-4-phenylselanyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 100988121 |
| Molecular Formula | C26H26O3Se |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | methyl (3R,4S,5R)-5-ethyl-2,2-diphenyl-4-phenylselanyloxolane-3-carboxylate |
| SMILES | CC[C@H]1OC(c2ccccc2)(c2ccccc2)[C@H](C(=O)OC)[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C26H26O3Se/c1-3-22-24(30-21-17-11-6-12-18-21)23(25(27)28-2)26(29-22,19-13-7-4-8-14-19)20-15-9-5-10-16-20/h4-18,22-24H,3H2,1-2H3/t22-,23+,24-/m1/s1 |
| InChIKey | CQLZICSNAKKDHN-TZRRMPRUSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|