C20H22O3Se — CID 100988123
methyl (2R,3R,4S,5R)-5-ethyl-2-phenyl-4-phenylselanyloxolane-3-carboxylate (PubChem CID 100988123) has the molecular formula C20H22O3Se and a molecular weight of 389.35 g/mol. Its IUPAC name is methyl (2R,3R,4S,5R)-5-ethyl-2-phenyl-4-phenylselanyloxolane-3-carboxylate.
| Compound Name | methyl (2R,3R,4S,5R)-5-ethyl-2-phenyl-4-phenylselanyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 100988123 |
| Molecular Formula | C20H22O3Se |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl (2R,3R,4S,5R)-5-ethyl-2-phenyl-4-phenylselanyloxolane-3-carboxylate |
| SMILES | CC[C@H]1O[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C20H22O3Se/c1-3-16-19(24-15-12-8-5-9-13-15)17(20(21)22-2)18(23-16)14-10-6-4-7-11-14/h4-13,16-19H,3H2,1-2H3/t16-,17+,18+,19-/m1/s1 |
| InChIKey | PFQGGJZUGULKLD-YDZRNGNQSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|