methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate

C12H14O3S — CID 15926581

IUPACmethyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate
SMILESCOC(=O)CSC[C@H]1O[C@H]1c1ccccc1
InChIInChI=1S/C12H14O3S/c1-14-11(13)8-16-7-10-12(15-10)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3/t10-,12+/m1/s1
InChIKeyMEGQUFITDRJRHA-PWSUYJOCSA-N
MW238.31 g/mol
LogP2.03
Rot. Bonds5

About methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate

methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate (PubChem CID 15926581) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate.

Molecular Properties

Compound Namemethyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate
PubChem CID15926581
Molecular FormulaC12H14O3S
Molecular Weight238.31 g/mol
Exact Mass238.07
IUPAC Namemethyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate
SMILESCOC(=O)CSC[C@H]1O[C@H]1c1ccccc1
InChIInChI=1S/C12H14O3S/c1-14-11(13)8-16-7-10-12(15-10)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3/t10-,12+/m1/s1
InChIKeyMEGQUFITDRJRHA-PWSUYJOCSA-N
XLogP2.03
TPSA38.83 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.31
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate?
The IUPAC name of methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate (CID 15926581) is methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate.
What is the SMILES notation for methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate?
The canonical SMILES for methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate is COC(=O)CSC[C@H]1O[C@H]1c1ccccc1.
What is the InChIKey of methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate?
The InChIKey is MEGQUFITDRJRHA-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H14O3S/c1-14-11(13)8-16-7-10-12(15-10)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3/t10-,12+/m1/s1.
What are the key properties of methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate?
methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate has a molecular weight of 238.31 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate is sourced from PubChem (CID 15926581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).