C12H14O3S — CID 15926581
methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate (PubChem CID 15926581) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 15926581 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | methyl 2-[[(2S,3S)-3-phenyloxiran-2-yl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSC[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H14O3S/c1-14-11(13)8-16-7-10-12(15-10)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3/t10-,12+/m1/s1 |
| InChIKey | MEGQUFITDRJRHA-PWSUYJOCSA-N |
| XLogP | 2.03 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|