C20H22O3 — CID 71352791
methyl 4-[(2S,3S)-3-(4-benzylphenyl)oxiran-2-yl]butanoate (PubChem CID 71352791) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 4-[(2S,3S)-3-(4-benzylphenyl)oxiran-2-yl]butanoate.
| Compound Name | methyl 4-[(2S,3S)-3-(4-benzylphenyl)oxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 71352791 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl 4-[(2S,3S)-3-(4-benzylphenyl)oxiran-2-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1O[C@H]1c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O3/c1-22-19(21)9-5-8-18-20(23-18)17-12-10-16(11-13-17)14-15-6-3-2-4-7-15/h2-4,6-7,10-13,18,20H,5,8-9,14H2,1H3/t18-,20-/m0/s1 |
| InChIKey | GBIXVIMILYDXLE-ICSRJNTNSA-N |
| XLogP | 4.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|