C17H24N2O4 — CID 10615658
(4R,5R)-2-ethyl-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 10615658) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (4R,5R)-2-ethyl-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-2-ethyl-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 10615658 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (4R,5R)-2-ethyl-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | CCC1(c2ccccc2)O[C@@H](C(=O)N(C)C)[C@H](C(=O)N(C)C)O1 |
| InChI | InChI=1S/C17H24N2O4/c1-6-17(12-10-8-7-9-11-12)22-13(15(20)18(2)3)14(23-17)16(21)19(4)5/h7-11,13-14H,6H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | OECNZFPXXSWWNK-ZIAGYGMSSA-N |
| XLogP | 1.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |