C24H28N2O2 — CID 71671613
15-N,15-N,16-N,16-N,1,8-hexamethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide (PubChem CID 71671613) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 15-N,15-N,16-N,16-N,1,8-hexamethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide.
| Compound Name | 15-N,15-N,16-N,16-N,1,8-hexamethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide |
|---|---|
| PubChem CID | 71671613 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 15-N,15-N,16-N,16-N,1,8-hexamethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide |
| SMILES | CN(C)C(=O)C1C(C(=O)N(C)C)C2(C)c3ccccc3C1(C)c1ccccc12 |
| InChI | InChI=1S/C24H28N2O2/c1-23-15-11-7-9-13-17(15)24(2,18-14-10-8-12-16(18)23)20(22(28)26(5)6)19(23)21(27)25(3)4/h7-14,19-20H,1-6H3 |
| InChIKey | FNHOXMWBSPLBHO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |