C29H26NO2P — CID 139162018
methyl (4S)-2,2,5,5-tetraphenyl-1-aza-2λ5-phosphacyclopentene-4-carboxylate (PubChem CID 139162018) has the molecular formula C29H26NO2P and a molecular weight of 451.51 g/mol. Its IUPAC name is methyl (4S)-2,2,5,5-tetraphenyl-1-aza-2λ5-phosphacyclopentene-4-carboxylate.
| Compound Name | methyl (4S)-2,2,5,5-tetraphenyl-1-aza-2λ5-phosphacyclopentene-4-carboxylate |
|---|---|
| PubChem CID | 139162018 |
| Molecular Formula | C29H26NO2P |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | methyl (4S)-2,2,5,5-tetraphenyl-1-aza-2λ5-phosphacyclopentene-4-carboxylate |
| SMILES | COC(=O)[C@H]1CP(c2ccccc2)(c2ccccc2)=NC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26NO2P/c1-32-28(31)27-22-33(25-18-10-4-11-19-25,26-20-12-5-13-21-26)30-29(27,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h2-21,27H,22H2,1H3/t27-/m1/s1 |
| InChIKey | PKAMBOONSIVJHL-HHHXNRCGSA-N |
| XLogP | 5.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|