C13H14O3 — CID 134986288
methyl 2-benzyl-2-formylcyclopropane-1-carboxylate (PubChem CID 134986288) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl 2-benzyl-2-formylcyclopropane-1-carboxylate.
| Compound Name | methyl 2-benzyl-2-formylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134986288 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | methyl 2-benzyl-2-formylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1CC1(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H14O3/c1-16-12(15)11-8-13(11,9-14)7-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | PNXMGUQOQRMXLG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|