C18H23NO3S — CID 129356183
methyl (2S)-6-(2-benzylsulfanylacetyl)-6-azaspiro[2.5]octane-2-carboxylate (PubChem CID 129356183) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is methyl (2S)-6-(2-benzylsulfanylacetyl)-6-azaspiro[2.5]octane-2-carboxylate.
| Compound Name | methyl (2S)-6-(2-benzylsulfanylacetyl)-6-azaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 129356183 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | methyl (2S)-6-(2-benzylsulfanylacetyl)-6-azaspiro[2.5]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC12CCN(C(=O)CSCc1ccccc1)CC2 |
| InChI | InChI=1S/C18H23NO3S/c1-22-17(21)15-11-18(15)7-9-19(10-8-18)16(20)13-23-12-14-5-3-2-4-6-14/h2-6,15H,7-13H2,1H3/t15-/m1/s1 |
| InChIKey | CEBUPWRBSPHTAO-OAHLLOKOSA-N |
| XLogP | 2.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |