C15H19NO3S — CID 121021108
methyl 6-(2-thiophen-3-ylacetyl)-6-azaspiro[2.5]octane-2-carboxylate (PubChem CID 121021108) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is methyl 6-(2-thiophen-3-ylacetyl)-6-azaspiro[2.5]octane-2-carboxylate.
| Compound Name | methyl 6-(2-thiophen-3-ylacetyl)-6-azaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 121021108 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | methyl 6-(2-thiophen-3-ylacetyl)-6-azaspiro[2.5]octane-2-carboxylate |
| SMILES | COC(=O)C1CC12CCN(C(=O)Cc1ccsc1)CC2 |
| InChI | InChI=1S/C15H19NO3S/c1-19-14(18)12-9-15(12)3-5-16(6-4-15)13(17)8-11-2-7-20-10-11/h2,7,10,12H,3-6,8-9H2,1H3 |
| InChIKey | LFALOGIENYCHHX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |