C20H21NO4 — CID 134612623
dimethyl 5,5-diphenylpyrrolidine-2,4-dicarboxylate (PubChem CID 134612623) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is dimethyl 5,5-diphenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl 5,5-diphenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134612623 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | dimethyl 5,5-diphenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C1CC(C(=O)OC)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C20H21NO4/c1-24-18(22)16-13-17(19(23)25-2)21-20(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-17,21H,13H2,1-2H3 |
| InChIKey | BYUYLJZMAXVNNV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |