C19H19NO3 — CID 571094
methyl 4-ethyl-2,5-diphenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 571094) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 4-ethyl-2,5-diphenyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 4-ethyl-2,5-diphenyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 571094 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl 4-ethyl-2,5-diphenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | CCC1(C(=O)OC)N=C(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-3-19(18(21)22-2)16(14-10-6-4-7-11-14)23-17(20-19)15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3 |
| InChIKey | MOVWPDYFMFDRSU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |