C25H37NO6 — CID 69135024
methyl (4R,5S)-4-[(2R,3S)-2-hydroxy-3-methoxycarbonylnonyl]-2-phenyl-5-propan-2-yl-5H-1,3-oxazole-4-carboxylate (PubChem CID 69135024) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is methyl (4R,5S)-4-[(2R,3S)-2-hydroxy-3-methoxycarbonylnonyl]-2-phenyl-5-propan-2-yl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4R,5S)-4-[(2R,3S)-2-hydroxy-3-methoxycarbonylnonyl]-2-phenyl-5-propan-2-yl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 69135024 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | methyl (4R,5S)-4-[(2R,3S)-2-hydroxy-3-methoxycarbonylnonyl]-2-phenyl-5-propan-2-yl-5H-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCC[C@H](C(=O)OC)[C@H](O)C[C@@]1(C(=O)OC)N=C(c2ccccc2)O[C@H]1C(C)C |
| InChI | InChI=1S/C25H37NO6/c1-6-7-8-12-15-19(23(28)30-4)20(27)16-25(24(29)31-5)21(17(2)3)32-22(26-25)18-13-10-9-11-14-18/h9-11,13-14,17,19-21,27H,6-8,12,15-16H2,1-5H3/t19-,20+,21-,25+/m0/s1 |
| InChIKey | XFGPPGWURVWLEG-UGCAPWQASA-N |
| XLogP | 3.91 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|