C33H30BrNO5 — CID 23920263
methyl (4R,5R)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxylate (PubChem CID 23920263) has the molecular formula C33H30BrNO5 and a molecular weight of 600.51 g/mol. Its IUPAC name is methyl (4R,5R)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4R,5R)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23920263 |
| Molecular Formula | C33H30BrNO5 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | methyl (4R,5R)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30BrNO5/c1-38-32(37)33(22-23-8-16-28(34)17-9-23)30(26-12-10-25(11-13-26)24-6-3-2-4-7-24)40-31(35-33)27-14-18-29(19-15-27)39-21-5-20-36/h2-4,6-19,30,36H,5,20-22H2,1H3/t30-,33-/m1/s1 |
| InChIKey | JQEAYVSYRZJKLB-LXANVCGNSA-N |
| XLogP | 6.55 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|