C33H30Br2N2O4 — CID 23835998
(4R,5R)-N-benzyl-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835998) has the molecular formula C33H30Br2N2O4 and a molecular weight of 678.42 g/mol. Its IUPAC name is (4R,5R)-N-benzyl-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-N-benzyl-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835998 |
| Molecular Formula | C33H30Br2N2O4 |
| Molecular Weight | 678.42 g/mol |
| Exact Mass | 676.06 |
| IUPAC Name | (4R,5R)-N-benzyl-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C33H30Br2N2O4/c34-27-13-7-23(8-14-27)21-33(32(39)36-22-24-5-2-1-3-6-24)30(25-9-15-28(35)16-10-25)41-31(37-33)26-11-17-29(18-12-26)40-20-4-19-38/h1-3,5-18,30,38H,4,19-22H2,(H,36,39)/t30-,33-/m1/s1 |
| InChIKey | OHAANGFHMBWIEQ-LXANVCGNSA-N |
| XLogP | 6.79 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.42 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|